C26H26N2O6 — CID 22148089
2-hydroxy-N-[(E)-3-(2-hydroxyethylamino)-1-[4-[(3-methoxyphenyl)methoxy]phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22148089) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is 2-hydroxy-N-[(E)-3-(2-hydroxyethylamino)-1-[4-[(3-methoxyphenyl)methoxy]phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 2-hydroxy-N-[(E)-3-(2-hydroxyethylamino)-1-[4-[(3-methoxyphenyl)methoxy]phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22148089 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 2-hydroxy-N-[(E)-3-(2-hydroxyethylamino)-1-[4-[(3-methoxyphenyl)methoxy]phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(COc2ccc(/C=C(/NC(=O)c3ccccc3O)C(=O)NCCO)cc2)c1 |
| InChI | InChI=1S/C26H26N2O6/c1-33-21-6-4-5-19(15-21)17-34-20-11-9-18(10-12-20)16-23(26(32)27-13-14-29)28-25(31)22-7-2-3-8-24(22)30/h2-12,15-16,29-30H,13-14,17H2,1H3,(H,27,32)(H,28,31)/b23-16+ |
| InChIKey | HOMYNUWOJQCEKA-XQNSMLJCSA-N |
| XLogP | 2.86 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|