C22H23ClN2O4 — CID 22148332
(E)-3-[4-[(3-chloro-2-pyridinyl)oxy]phenyl]-2-(3-cyclopentylpropanoylamino)prop-2-enoic acid (PubChem CID 22148332) has the molecular formula C22H23ClN2O4 and a molecular weight of 414.89 g/mol. Its IUPAC name is (E)-3-[4-[(3-chloro-2-pyridinyl)oxy]phenyl]-2-(3-cyclopentylpropanoylamino)prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(3-chloro-2-pyridinyl)oxy]phenyl]-2-(3-cyclopentylpropanoylamino)prop-2-enoic acid |
|---|---|
| PubChem CID | 22148332 |
| Molecular Formula | C22H23ClN2O4 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | (E)-3-[4-[(3-chloro-2-pyridinyl)oxy]phenyl]-2-(3-cyclopentylpropanoylamino)prop-2-enoic acid |
| SMILES | O=C(CCC1CCCC1)N/C(=C/c1ccc(Oc2ncccc2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C22H23ClN2O4/c23-18-6-3-13-24-21(18)29-17-10-7-16(8-11-17)14-19(22(27)28)25-20(26)12-9-15-4-1-2-5-15/h3,6-8,10-11,13-15H,1-2,4-5,9,12H2,(H,25,26)(H,27,28)/b19-14+ |
| InChIKey | HLIXLCZJCAFAKA-XMHGGMMESA-N |
| XLogP | 5.04 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|