C23H24ClNO4 — CID 22148086
(E)-3-[4-(2-chlorophenoxy)phenyl]-2-(3-cyclopentylpropanoylamino)prop-2-enoic acid (PubChem CID 22148086) has the molecular formula C23H24ClNO4 and a molecular weight of 413.90 g/mol. Its IUPAC name is (E)-3-[4-(2-chlorophenoxy)phenyl]-2-(3-cyclopentylpropanoylamino)prop-2-enoic acid.
| Compound Name | (E)-3-[4-(2-chlorophenoxy)phenyl]-2-(3-cyclopentylpropanoylamino)prop-2-enoic acid |
|---|---|
| PubChem CID | 22148086 |
| Molecular Formula | C23H24ClNO4 |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | (E)-3-[4-(2-chlorophenoxy)phenyl]-2-(3-cyclopentylpropanoylamino)prop-2-enoic acid |
| SMILES | O=C(CCC1CCCC1)N/C(=C/c1ccc(Oc2ccccc2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C23H24ClNO4/c24-19-7-3-4-8-21(19)29-18-12-9-17(10-13-18)15-20(23(27)28)25-22(26)14-11-16-5-1-2-6-16/h3-4,7-10,12-13,15-16H,1-2,5-6,11,14H2,(H,25,26)(H,27,28)/b20-15+ |
| InChIKey | HTQWJNKUTFTGHB-HMMYKYKNSA-N |
| XLogP | 5.64 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|