C24H19BrClNO4 — CID 22148260
(E)-3-[4-(2-bromophenoxy)phenyl]-2-[3-(4-chlorophenyl)propanoylamino]prop-2-enoic acid (PubChem CID 22148260) has the molecular formula C24H19BrClNO4 and a molecular weight of 500.78 g/mol. Its IUPAC name is (E)-3-[4-(2-bromophenoxy)phenyl]-2-[3-(4-chlorophenyl)propanoylamino]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(2-bromophenoxy)phenyl]-2-[3-(4-chlorophenyl)propanoylamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 22148260 |
| Molecular Formula | C24H19BrClNO4 |
| Molecular Weight | 500.78 g/mol |
| Exact Mass | 499.02 |
| IUPAC Name | (E)-3-[4-(2-bromophenoxy)phenyl]-2-[3-(4-chlorophenyl)propanoylamino]prop-2-enoic acid |
| SMILES | O=C(CCc1ccc(Cl)cc1)N/C(=C/c1ccc(Oc2ccccc2Br)cc1)C(=O)O |
| InChI | InChI=1S/C24H19BrClNO4/c25-20-3-1-2-4-22(20)31-19-12-7-17(8-13-19)15-21(24(29)30)27-23(28)14-9-16-5-10-18(26)11-6-16/h1-8,10-13,15H,9,14H2,(H,27,28)(H,29,30)/b21-15+ |
| InChIKey | YUBHYLSDKOBLSA-RCCKNPSSSA-N |
| XLogP | 6.07 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.78 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|