C24H17BrF3NO4 — CID 58631855
(Z)-3-[4-(2-bromophenoxy)phenyl]-2-[[2-[2-(trifluoromethyl)phenyl]acetyl]amino]prop-2-enoic acid (PubChem CID 58631855) has the molecular formula C24H17BrF3NO4 and a molecular weight of 520.30 g/mol. Its IUPAC name is (Z)-3-[4-(2-bromophenoxy)phenyl]-2-[[2-[2-(trifluoromethyl)phenyl]acetyl]amino]prop-2-enoic acid.
| Compound Name | (Z)-3-[4-(2-bromophenoxy)phenyl]-2-[[2-[2-(trifluoromethyl)phenyl]acetyl]amino]prop-2-enoic acid |
|---|---|
| PubChem CID | 58631855 |
| Molecular Formula | C24H17BrF3NO4 |
| Molecular Weight | 520.30 g/mol |
| Exact Mass | 519.03 |
| IUPAC Name | (Z)-3-[4-(2-bromophenoxy)phenyl]-2-[[2-[2-(trifluoromethyl)phenyl]acetyl]amino]prop-2-enoic acid |
| SMILES | O=C(Cc1ccccc1C(F)(F)F)N/C(=C\c1ccc(Oc2ccccc2Br)cc1)C(=O)O |
| InChI | InChI=1S/C24H17BrF3NO4/c25-19-7-3-4-8-21(19)33-17-11-9-15(10-12-17)13-20(23(31)32)29-22(30)14-16-5-1-2-6-18(16)24(26,27)28/h1-13H,14H2,(H,29,30)(H,31,32)/b20-13- |
| InChIKey | CMJWYJPLFBCPKN-MOSHPQCFSA-N |
| XLogP | 6.04 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.30 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|