C23H17Br2NO4 — CID 58631676
(Z)-3-[4-(2-bromophenoxy)phenyl]-2-[[2-(3-bromophenyl)acetyl]amino]prop-2-enoic acid (PubChem CID 58631676) has the molecular formula C23H17Br2NO4 and a molecular weight of 531.20 g/mol. Its IUPAC name is (Z)-3-[4-(2-bromophenoxy)phenyl]-2-[[2-(3-bromophenyl)acetyl]amino]prop-2-enoic acid.
| Compound Name | (Z)-3-[4-(2-bromophenoxy)phenyl]-2-[[2-(3-bromophenyl)acetyl]amino]prop-2-enoic acid |
|---|---|
| PubChem CID | 58631676 |
| Molecular Formula | C23H17Br2NO4 |
| Molecular Weight | 531.20 g/mol |
| Exact Mass | 528.95 |
| IUPAC Name | (Z)-3-[4-(2-bromophenoxy)phenyl]-2-[[2-(3-bromophenyl)acetyl]amino]prop-2-enoic acid |
| SMILES | O=C(Cc1cccc(Br)c1)N/C(=C\c1ccc(Oc2ccccc2Br)cc1)C(=O)O |
| InChI | InChI=1S/C23H17Br2NO4/c24-17-5-3-4-16(12-17)14-22(27)26-20(23(28)29)13-15-8-10-18(11-9-15)30-21-7-2-1-6-19(21)25/h1-13H,14H2,(H,26,27)(H,28,29)/b20-13- |
| InChIKey | KPRPNWDJSNZVRC-MOSHPQCFSA-N |
| XLogP | 5.79 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.20 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|