C23H17BrClNO4 — CID 6321106
3-[4-(2-bromophenoxy)phenyl]-2-[[2-(4-chlorophenyl)acetyl]amino]prop-2-enoic acid (PubChem CID 6321106) has the molecular formula C23H17BrClNO4 and a molecular weight of 486.75 g/mol. Its IUPAC name is 3-[4-(2-bromophenoxy)phenyl]-2-[[2-(4-chlorophenyl)acetyl]amino]prop-2-enoic acid.
| Compound Name | 3-[4-(2-bromophenoxy)phenyl]-2-[[2-(4-chlorophenyl)acetyl]amino]prop-2-enoic acid |
|---|---|
| PubChem CID | 6321106 |
| Molecular Formula | C23H17BrClNO4 |
| Molecular Weight | 486.75 g/mol |
| Exact Mass | 485.00 |
| IUPAC Name | 3-[4-(2-bromophenoxy)phenyl]-2-[[2-(4-chlorophenyl)acetyl]amino]prop-2-enoic acid |
| SMILES | O=C(Cc1ccc(Cl)cc1)NC(=Cc1ccc(Oc2ccccc2Br)cc1)C(=O)O |
| InChI | InChI=1S/C23H17BrClNO4/c24-19-3-1-2-4-21(19)30-18-11-7-15(8-12-18)13-20(23(28)29)26-22(27)14-16-5-9-17(25)10-6-16/h1-13H,14H2,(H,26,27)(H,28,29) |
| InChIKey | BYDYYXDWYBWSRU-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.75 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|