C26H21BrClNO4 — CID 58631753
(Z)-3-[4-(2-bromophenoxy)phenyl]-2-[[1-(4-chlorophenyl)cyclobutanecarbonyl]amino]prop-2-enoic acid (PubChem CID 58631753) has the molecular formula C26H21BrClNO4 and a molecular weight of 526.81 g/mol. Its IUPAC name is (Z)-3-[4-(2-bromophenoxy)phenyl]-2-[[1-(4-chlorophenyl)cyclobutanecarbonyl]amino]prop-2-enoic acid.
| Compound Name | (Z)-3-[4-(2-bromophenoxy)phenyl]-2-[[1-(4-chlorophenyl)cyclobutanecarbonyl]amino]prop-2-enoic acid |
|---|---|
| PubChem CID | 58631753 |
| Molecular Formula | C26H21BrClNO4 |
| Molecular Weight | 526.81 g/mol |
| Exact Mass | 525.03 |
| IUPAC Name | (Z)-3-[4-(2-bromophenoxy)phenyl]-2-[[1-(4-chlorophenyl)cyclobutanecarbonyl]amino]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C/c1ccc(Oc2ccccc2Br)cc1)NC(=O)C1(c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C26H21BrClNO4/c27-21-4-1-2-5-23(21)33-20-12-6-17(7-13-20)16-22(24(30)31)29-25(32)26(14-3-15-26)18-8-10-19(28)11-9-18/h1-2,4-13,16H,3,14-15H2,(H,29,32)(H,30,31)/b22-16- |
| InChIKey | FIVDKHHUMVZAPD-JWGURIENSA-N |
| XLogP | 6.56 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.81 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|