C28H25BrClNO4 — CID 23571265
(E)-3-[4-(2-bromophenoxy)phenyl]-2-[2-(6-chloro-2,3-dihydro-1H-inden-5-yl)butanoylamino]prop-2-enoic acid (PubChem CID 23571265) has the molecular formula C28H25BrClNO4 and a molecular weight of 554.87 g/mol. Its IUPAC name is (E)-3-[4-(2-bromophenoxy)phenyl]-2-[2-(6-chloro-2,3-dihydro-1H-inden-5-yl)butanoylamino]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(2-bromophenoxy)phenyl]-2-[2-(6-chloro-2,3-dihydro-1H-inden-5-yl)butanoylamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 23571265 |
| Molecular Formula | C28H25BrClNO4 |
| Molecular Weight | 554.87 g/mol |
| Exact Mass | 553.07 |
| IUPAC Name | (E)-3-[4-(2-bromophenoxy)phenyl]-2-[2-(6-chloro-2,3-dihydro-1H-inden-5-yl)butanoylamino]prop-2-enoic acid |
| SMILES | CCC(C(=O)N/C(=C/c1ccc(Oc2ccccc2Br)cc1)C(=O)O)c1cc2c(cc1Cl)CCC2 |
| InChI | InChI=1S/C28H25BrClNO4/c1-2-21(22-15-18-6-5-7-19(18)16-24(22)30)27(32)31-25(28(33)34)14-17-10-12-20(13-11-17)35-26-9-4-3-8-23(26)29/h3-4,8-16,21H,2,5-7H2,1H3,(H,31,32)(H,33,34)/b25-14+ |
| InChIKey | CDEOUMWOXWSIDU-AFUMVMLFSA-N |
| XLogP | 7.12 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.87 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|