C24H26BrNO4 — CID 58631687
(Z)-3-[4-(2-bromophenoxy)phenyl]-2-[[2-(4-methylcyclohexyl)acetyl]amino]prop-2-enoic acid (PubChem CID 58631687) has the molecular formula C24H26BrNO4 and a molecular weight of 472.38 g/mol. Its IUPAC name is (Z)-3-[4-(2-bromophenoxy)phenyl]-2-[[2-(4-methylcyclohexyl)acetyl]amino]prop-2-enoic acid.
| Compound Name | (Z)-3-[4-(2-bromophenoxy)phenyl]-2-[[2-(4-methylcyclohexyl)acetyl]amino]prop-2-enoic acid |
|---|---|
| PubChem CID | 58631687 |
| Molecular Formula | C24H26BrNO4 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | (Z)-3-[4-(2-bromophenoxy)phenyl]-2-[[2-(4-methylcyclohexyl)acetyl]amino]prop-2-enoic acid |
| SMILES | CC1CCC(CC(=O)N/C(=C\c2ccc(Oc3ccccc3Br)cc2)C(=O)O)CC1 |
| InChI | InChI=1S/C24H26BrNO4/c1-16-6-8-18(9-7-16)15-23(27)26-21(24(28)29)14-17-10-12-19(13-11-17)30-22-5-3-2-4-20(22)25/h2-5,10-14,16,18H,6-9,15H2,1H3,(H,26,27)(H,28,29)/b21-14- |
| InChIKey | ICKYTLRZVSVWMY-STZFKDTASA-N |
| XLogP | 6.00 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|