C20H20BrNO4 — CID 22148208
(Z)-3-[4-(2-bromophenoxy)phenyl]-2-(pentanoylamino)prop-2-enoic acid (PubChem CID 22148208) has the molecular formula C20H20BrNO4 and a molecular weight of 418.29 g/mol. Its IUPAC name is (Z)-3-[4-(2-bromophenoxy)phenyl]-2-(pentanoylamino)prop-2-enoic acid.
| Compound Name | (Z)-3-[4-(2-bromophenoxy)phenyl]-2-(pentanoylamino)prop-2-enoic acid |
|---|---|
| PubChem CID | 22148208 |
| Molecular Formula | C20H20BrNO4 |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | (Z)-3-[4-(2-bromophenoxy)phenyl]-2-(pentanoylamino)prop-2-enoic acid |
| SMILES | CCCCC(=O)N/C(=C\c1ccc(Oc2ccccc2Br)cc1)C(=O)O |
| InChI | InChI=1S/C20H20BrNO4/c1-2-3-8-19(23)22-17(20(24)25)13-14-9-11-15(12-10-14)26-18-7-5-4-6-16(18)21/h4-7,9-13H,2-3,8H2,1H3,(H,22,23)(H,24,25)/b17-13- |
| InChIKey | XJBDPTLPQLCHDE-LGMDPLHJSA-N |
| XLogP | 4.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|