C24H26ClNO4 — CID 22148671
(E)-3-[4-(2-chlorophenoxy)-3-methylphenyl]-2-(3-cyclopentylpropanoylamino)prop-2-enoic acid (PubChem CID 22148671) has the molecular formula C24H26ClNO4 and a molecular weight of 427.93 g/mol. Its IUPAC name is (E)-3-[4-(2-chlorophenoxy)-3-methylphenyl]-2-(3-cyclopentylpropanoylamino)prop-2-enoic acid.
| Compound Name | (E)-3-[4-(2-chlorophenoxy)-3-methylphenyl]-2-(3-cyclopentylpropanoylamino)prop-2-enoic acid |
|---|---|
| PubChem CID | 22148671 |
| Molecular Formula | C24H26ClNO4 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | (E)-3-[4-(2-chlorophenoxy)-3-methylphenyl]-2-(3-cyclopentylpropanoylamino)prop-2-enoic acid |
| SMILES | Cc1cc(/C=C(/NC(=O)CCC2CCCC2)C(=O)O)ccc1Oc1ccccc1Cl |
| InChI | InChI=1S/C24H26ClNO4/c1-16-14-18(10-12-21(16)30-22-9-5-4-8-19(22)25)15-20(24(28)29)26-23(27)13-11-17-6-2-3-7-17/h4-5,8-10,12,14-15,17H,2-3,6-7,11,13H2,1H3,(H,26,27)(H,28,29)/b20-15+ |
| InChIKey | ZZRXLJIAYHKKMK-HMMYKYKNSA-N |
| XLogP | 5.95 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|