C18H11BrN2O2S — CID 2215189
N-[2-(1,3-benzothiazol-2-yl)phenyl]-5-bromofuran-2-carboxamide (PubChem CID 2215189) has the molecular formula C18H11BrN2O2S and a molecular weight of 399.27 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)phenyl]-5-bromofuran-2-carboxamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]-5-bromofuran-2-carboxamide |
|---|---|
| PubChem CID | 2215189 |
| Molecular Formula | C18H11BrN2O2S |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]-5-bromofuran-2-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1nc2ccccc2s1)c1ccc(Br)o1 |
| InChI | InChI=1S/C18H11BrN2O2S/c19-16-10-9-14(23-16)17(22)20-12-6-2-1-5-11(12)18-21-13-7-3-4-8-15(13)24-18/h1-10H,(H,20,22) |
| InChIKey | JDQYCVDWNOVBFL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |