C42H56O10 — CID 22152003
(1-acetylperoxy-9,10,11,12-tetrapentoxytriphenylen-2-yl) ethaneperoxoate (PubChem CID 22152003) has the molecular formula C42H56O10 and a molecular weight of 720.90 g/mol. Its IUPAC name is (1-acetylperoxy-9,10,11,12-tetrapentoxytriphenylen-2-yl) ethaneperoxoate.
| Compound Name | (1-acetylperoxy-9,10,11,12-tetrapentoxytriphenylen-2-yl) ethaneperoxoate |
|---|---|
| PubChem CID | 22152003 |
| Molecular Formula | C42H56O10 |
| Molecular Weight | 720.90 g/mol |
| Exact Mass | 720.39 |
| IUPAC Name | (1-acetylperoxy-9,10,11,12-tetrapentoxytriphenylen-2-yl) ethaneperoxoate |
| SMILES | CCCCCOc1c(OCCCCC)c(OCCCCC)c2c3c(OOC(C)=O)c(OOC(C)=O)ccc3c3ccccc3c2c1OCCCCC |
| InChI | InChI=1S/C42H56O10/c1-7-11-17-25-45-39-36-32-22-16-15-21-31(32)33-23-24-34(51-49-29(5)43)38(52-50-30(6)44)35(33)37(36)40(46-26-18-12-8-2)42(48-28-20-14-10-4)41(39)47-27-19-13-9-3/h15-16,21-24H,7-14,17-20,25-28H2,1-6H3 |
| InChIKey | FKOPFQWQQWWICS-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.90 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|