C18H18Cl2N2O — CID 22153049
4-chloro-N-(3-chloro-2-methylphenyl)-2,6-dimethyl-5-prop-2-enylpyridine-3-carboxamide (PubChem CID 22153049) has the molecular formula C18H18Cl2N2O and a molecular weight of 349.26 g/mol. Its IUPAC name is 4-chloro-N-(3-chloro-2-methylphenyl)-2,6-dimethyl-5-prop-2-enylpyridine-3-carboxamide.
| Compound Name | 4-chloro-N-(3-chloro-2-methylphenyl)-2,6-dimethyl-5-prop-2-enylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 22153049 |
| Molecular Formula | C18H18Cl2N2O |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 4-chloro-N-(3-chloro-2-methylphenyl)-2,6-dimethyl-5-prop-2-enylpyridine-3-carboxamide |
| SMILES | C=CCc1c(C)nc(C)c(C(=O)Nc2cccc(Cl)c2C)c1Cl |
| InChI | InChI=1S/C18H18Cl2N2O/c1-5-7-13-11(3)21-12(4)16(17(13)20)18(23)22-15-9-6-8-14(19)10(15)2/h5-6,8-9H,1,7H2,2-4H3,(H,22,23) |
| InChIKey | SEKJRXQMOWQWJS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|