C22H27ClN2O3 — CID 22153064
4-chloro-N-(2,6-diethyl-4-methoxyphenyl)-2,6-dimethyl-1-oxido-5-prop-2-enylpyridin-1-ium-3-carboxamide (PubChem CID 22153064) has the molecular formula C22H27ClN2O3 and a molecular weight of 402.92 g/mol. Its IUPAC name is 4-chloro-N-(2,6-diethyl-4-methoxyphenyl)-2,6-dimethyl-1-oxido-5-prop-2-enylpyridin-1-ium-3-carboxamide.
| Compound Name | 4-chloro-N-(2,6-diethyl-4-methoxyphenyl)-2,6-dimethyl-1-oxido-5-prop-2-enylpyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 22153064 |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 4-chloro-N-(2,6-diethyl-4-methoxyphenyl)-2,6-dimethyl-1-oxido-5-prop-2-enylpyridin-1-ium-3-carboxamide |
| SMILES | C=CCc1c(Cl)c(C(=O)Nc2c(CC)cc(OC)cc2CC)c(C)[n+]([O-])c1C |
| InChI | InChI=1S/C22H27ClN2O3/c1-7-10-18-13(4)25(27)14(5)19(20(18)23)22(26)24-21-15(8-2)11-17(28-6)12-16(21)9-3/h7,11-12H,1,8-10H2,2-6H3,(H,24,26) |
| InChIKey | BJFKONBXUQEZLG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 65.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|