C22H27FN2O2 — CID 54135247
5-but-2-enyl-N-(2,6-diethylphenyl)-4-fluoro-2,6-dimethyl-1-oxidopyridin-1-ium-3-carboxamide (PubChem CID 54135247) has the molecular formula C22H27FN2O2 and a molecular weight of 370.47 g/mol. Its IUPAC name is 5-but-2-enyl-N-(2,6-diethylphenyl)-4-fluoro-2,6-dimethyl-1-oxidopyridin-1-ium-3-carboxamide.
| Compound Name | 5-but-2-enyl-N-(2,6-diethylphenyl)-4-fluoro-2,6-dimethyl-1-oxidopyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 54135247 |
| Molecular Formula | C22H27FN2O2 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 5-but-2-enyl-N-(2,6-diethylphenyl)-4-fluoro-2,6-dimethyl-1-oxidopyridin-1-ium-3-carboxamide |
| SMILES | CC=CCc1c(F)c(C(=O)Nc2c(CC)cccc2CC)c(C)[n+]([O-])c1C |
| InChI | InChI=1S/C22H27FN2O2/c1-6-9-13-18-14(4)25(27)15(5)19(20(18)23)22(26)24-21-16(7-2)11-10-12-17(21)8-3/h6,9-12H,7-8,13H2,1-5H3,(H,24,26) |
| InChIKey | NXFOODQZYGUJHG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 56.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|