C7H13FN4O2 — CID 22155156
4-amino-1-[(dimethylamino)methyl]-5-fluoropyrimidin-2-one;hydrate (PubChem CID 22155156) has the molecular formula C7H13FN4O2 and a molecular weight of 204.21 g/mol. Its IUPAC name is 4-amino-1-[(dimethylamino)methyl]-5-fluoropyrimidin-2-one;hydrate.
| Compound Name | 4-amino-1-[(dimethylamino)methyl]-5-fluoropyrimidin-2-one;hydrate |
|---|---|
| PubChem CID | 22155156 |
| Molecular Formula | C7H13FN4O2 |
| Molecular Weight | 204.21 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 4-amino-1-[(dimethylamino)methyl]-5-fluoropyrimidin-2-one;hydrate |
| SMILES | CN(C)Cn1cc(F)c(N)nc1=O.O |
| InChI | InChI=1S/C7H11FN4O.H2O/c1-11(2)4-12-3-5(8)6(9)10-7(12)13;/h3H,4H2,1-2H3,(H2,9,10,13);1H2 |
| InChIKey | UTRLYUNCYJMDNA-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.21 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |