C14H8Cl3N3O2 — CID 22156724
2,9-dichloro-11-(2-chloroacetyl)-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one (PubChem CID 22156724) has the molecular formula C14H8Cl3N3O2 and a molecular weight of 356.60 g/mol. Its IUPAC name is 2,9-dichloro-11-(2-chloroacetyl)-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one.
| Compound Name | 2,9-dichloro-11-(2-chloroacetyl)-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 22156724 |
| Molecular Formula | C14H8Cl3N3O2 |
| Molecular Weight | 356.60 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | 2,9-dichloro-11-(2-chloroacetyl)-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
| SMILES | O=C1Nc2ccc(Cl)nc2N(C(=O)CCl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C14H8Cl3N3O2/c15-6-12(21)20-10-5-7(16)1-2-8(10)14(22)18-9-3-4-11(17)19-13(9)20/h1-5H,6H2,(H,18,22) |
| InChIKey | HIHBNBWENCCFHS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.60 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|