C20H23ClIN3O4 — CID 110168866
[2-(3-chloro-6-oxo-5H-benzo[b][1,4]benzodiazepin-11-yl)-2-oxoethyl]-bis(2-hydroxyethyl)-methylazanium iodide (PubChem CID 110168866) has the molecular formula C20H23ClIN3O4 and a molecular weight of 531.78 g/mol. Its IUPAC name is [2-(3-chloro-6-oxo-5H-benzo[b][1,4]benzodiazepin-11-yl)-2-oxoethyl]-bis(2-hydroxyethyl)-methylazanium iodide.
| Compound Name | [2-(3-chloro-6-oxo-5H-benzo[b][1,4]benzodiazepin-11-yl)-2-oxoethyl]-bis(2-hydroxyethyl)-methylazanium iodide |
|---|---|
| PubChem CID | 110168866 |
| Molecular Formula | C20H23ClIN3O4 |
| Molecular Weight | 531.78 g/mol |
| Exact Mass | 531.04 |
| IUPAC Name | [2-(3-chloro-6-oxo-5H-benzo[b][1,4]benzodiazepin-11-yl)-2-oxoethyl]-bis(2-hydroxyethyl)-methylazanium iodide |
| SMILES | C[N+](CCO)(CCO)CC(=O)N1c2ccc(Cl)cc2NC(=O)c2ccccc21.[I-] |
| InChI | InChI=1S/C20H22ClN3O4.HI/c1-24(8-10-25,9-11-26)13-19(27)23-17-5-3-2-4-15(17)20(28)22-16-12-14(21)6-7-18(16)23;/h2-7,12,25-26H,8-11,13H2,1H3;1H |
| InChIKey | XPGFEMDDTCAGKF-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.78 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|