C28H30ClN3O4 — CID 110169355
3-chloro-11-[6-[(3,4-dimethoxyphenyl)methylamino]hexanoyl]-5H-benzo[b][1,4]benzodiazepin-6-one (PubChem CID 110169355) has the molecular formula C28H30ClN3O4 and a molecular weight of 508.02 g/mol. Its IUPAC name is 3-chloro-11-[6-[(3,4-dimethoxyphenyl)methylamino]hexanoyl]-5H-benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 3-chloro-11-[6-[(3,4-dimethoxyphenyl)methylamino]hexanoyl]-5H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 110169355 |
| Molecular Formula | C28H30ClN3O4 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 3-chloro-11-[6-[(3,4-dimethoxyphenyl)methylamino]hexanoyl]-5H-benzo[b][1,4]benzodiazepin-6-one |
| SMILES | COc1ccc(CNCCCCCC(=O)N2c3ccc(Cl)cc3NC(=O)c3ccccc32)cc1OC |
| InChI | InChI=1S/C28H30ClN3O4/c1-35-25-14-11-19(16-26(25)36-2)18-30-15-7-3-4-10-27(33)32-23-9-6-5-8-21(23)28(34)31-22-17-20(29)12-13-24(22)32/h5-6,8-9,11-14,16-17,30H,3-4,7,10,15,18H2,1-2H3,(H,31,34) |
| InChIKey | WJIJNZRUPPAFSX-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|