C26H28ClN3O8 — CID 110194048
3-chloro-11-[6-(furan-2-ylmethylamino)hexanoyl]-5H-benzo[b][1,4]benzodiazepin-6-one;oxalic acid;hydrate (PubChem CID 110194048) has the molecular formula C26H28ClN3O8 and a molecular weight of 545.98 g/mol. Its IUPAC name is 3-chloro-11-[6-(furan-2-ylmethylamino)hexanoyl]-5H-benzo[b][1,4]benzodiazepin-6-one;oxalic acid;hydrate.
| Compound Name | 3-chloro-11-[6-(furan-2-ylmethylamino)hexanoyl]-5H-benzo[b][1,4]benzodiazepin-6-one;oxalic acid;hydrate |
|---|---|
| PubChem CID | 110194048 |
| Molecular Formula | C26H28ClN3O8 |
| Molecular Weight | 545.98 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | 3-chloro-11-[6-(furan-2-ylmethylamino)hexanoyl]-5H-benzo[b][1,4]benzodiazepin-6-one;oxalic acid;hydrate |
| SMILES | O.O=C(O)C(=O)O.O=C1Nc2cc(Cl)ccc2N(C(=O)CCCCCNCc2ccco2)c2ccccc21 |
| InChI | InChI=1S/C24H24ClN3O3.C2H2O4.H2O/c25-17-11-12-22-20(15-17)27-24(30)19-8-3-4-9-21(19)28(22)23(29)10-2-1-5-13-26-16-18-7-6-14-31-18;3-1(4)2(5)6;/h3-4,6-9,11-12,14-15,26H,1-2,5,10,13,16H2,(H,27,30);(H,3,4)(H,5,6);1H2 |
| InChIKey | XYCNSJUHUBQBLX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 180.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.98 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|