C24H33ClN4O3 — CID 110168887
11-[6-(4-methylpiperazin-1-yl)hexanoyl]-5H-benzo[b][1,4]benzodiazepin-6-one;hydrate;hydrochloride (PubChem CID 110168887) has the molecular formula C24H33ClN4O3 and a molecular weight of 461.01 g/mol. Its IUPAC name is 11-[6-(4-methylpiperazin-1-yl)hexanoyl]-5H-benzo[b][1,4]benzodiazepin-6-one;hydrate;hydrochloride.
| Compound Name | 11-[6-(4-methylpiperazin-1-yl)hexanoyl]-5H-benzo[b][1,4]benzodiazepin-6-one;hydrate;hydrochloride |
|---|---|
| PubChem CID | 110168887 |
| Molecular Formula | C24H33ClN4O3 |
| Molecular Weight | 461.01 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 11-[6-(4-methylpiperazin-1-yl)hexanoyl]-5H-benzo[b][1,4]benzodiazepin-6-one;hydrate;hydrochloride |
| SMILES | CN1CCN(CCCCCC(=O)N2c3ccccc3NC(=O)c3ccccc32)CC1.Cl.O |
| InChI | InChI=1S/C24H30N4O2.ClH.H2O/c1-26-15-17-27(18-16-26)14-8-2-3-13-23(29)28-21-11-6-4-9-19(21)24(30)25-20-10-5-7-12-22(20)28;;/h4-7,9-12H,2-3,8,13-18H2,1H3,(H,25,30);1H;1H2 |
| InChIKey | LFJHDNNZYYMBBO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.01 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|