C26H31N2O3+ — CID 2215708
[3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methyl-(2-phenylethyl)azanium (PubChem CID 2215708) has the molecular formula C26H31N2O3+ and a molecular weight of 419.55 g/mol. Its IUPAC name is [3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methyl-(2-phenylethyl)azanium.
| Compound Name | [3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methyl-(2-phenylethyl)azanium |
|---|---|
| PubChem CID | 2215708 |
| Molecular Formula | C26H31N2O3+ |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | [3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methyl-(2-phenylethyl)azanium |
| SMILES | CCOc1cc(C[NH2+]CCc2ccccc2)ccc1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C26H30N2O3/c1-3-30-25-17-22(18-27-16-15-21-10-5-4-6-11-21)13-14-24(25)31-19-26(29)28-23-12-8-7-9-20(23)2/h4-14,17,27H,3,15-16,18-19H2,1-2H3,(H,28,29)/p+1 |
| InChIKey | UVUXTEYJTVQABG-UHFFFAOYSA-O |
| XLogP | 3.72 |
| TPSA | 64.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|