C8H10F4 — CID 22157760
2-(difluoromethyl)-1,1-difluoro-5-methylhexa-2,4-diene (PubChem CID 22157760) has the molecular formula C8H10F4 and a molecular weight of 182.16 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,1-difluoro-5-methylhexa-2,4-diene.
| Compound Name | 2-(difluoromethyl)-1,1-difluoro-5-methylhexa-2,4-diene |
|---|---|
| PubChem CID | 22157760 |
| Molecular Formula | C8H10F4 |
| Molecular Weight | 182.16 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 2-(difluoromethyl)-1,1-difluoro-5-methylhexa-2,4-diene |
| SMILES | CC(C)=CC=C(C(F)F)C(F)F |
| InChI | InChI=1S/C8H10F4/c1-5(2)3-4-6(7(9)10)8(11)12/h3-4,7-8H,1-2H3 |
| InChIKey | WJUBBUUEZPOAGH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.16 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|