C25H25ClO3 — CID 22159760
(4-chlorophenyl) 2-[bis(2,6-dimethylphenyl)methoxy]acetate (PubChem CID 22159760) has the molecular formula C25H25ClO3 and a molecular weight of 408.93 g/mol. Its IUPAC name is (4-chlorophenyl) 2-[bis(2,6-dimethylphenyl)methoxy]acetate.
| Compound Name | (4-chlorophenyl) 2-[bis(2,6-dimethylphenyl)methoxy]acetate |
|---|---|
| PubChem CID | 22159760 |
| Molecular Formula | C25H25ClO3 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (4-chlorophenyl) 2-[bis(2,6-dimethylphenyl)methoxy]acetate |
| SMILES | Cc1cccc(C)c1C(OCC(=O)Oc1ccc(Cl)cc1)c1c(C)cccc1C |
| InChI | InChI=1S/C25H25ClO3/c1-16-7-5-8-17(2)23(16)25(24-18(3)9-6-10-19(24)4)28-15-22(27)29-21-13-11-20(26)12-14-21/h5-14,25H,15H2,1-4H3 |
| InChIKey | YWZRANNSRYHSKY-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|