C7H15NO2 — CID 22160871
5-(methoxymethyl)-2,2-dimethyl-1,3-oxazolidine (PubChem CID 22160871) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. Its IUPAC name is 5-(methoxymethyl)-2,2-dimethyl-1,3-oxazolidine.
| Compound Name | 5-(methoxymethyl)-2,2-dimethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 22160871 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | 5-(methoxymethyl)-2,2-dimethyl-1,3-oxazolidine |
| SMILES | COCC1CNC(C)(C)O1 |
| InChI | InChI=1S/C7H15NO2/c1-7(2)8-4-6(10-7)5-9-3/h6,8H,4-5H2,1-3H3 |
| InChIKey | CSOLCAOHJPQVLH-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |