C16H12N4O6 — CID 22162218
methyl 5-nitro-2-oxo-6-(pyridine-3-carbonylamino)-1,3-dihydroindole-3-carboxylate (PubChem CID 22162218) has the molecular formula C16H12N4O6 and a molecular weight of 356.29 g/mol. Its IUPAC name is methyl 5-nitro-2-oxo-6-(pyridine-3-carbonylamino)-1,3-dihydroindole-3-carboxylate.
| Compound Name | methyl 5-nitro-2-oxo-6-(pyridine-3-carbonylamino)-1,3-dihydroindole-3-carboxylate |
|---|---|
| PubChem CID | 22162218 |
| Molecular Formula | C16H12N4O6 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | methyl 5-nitro-2-oxo-6-(pyridine-3-carbonylamino)-1,3-dihydroindole-3-carboxylate |
| SMILES | COC(=O)C1C(=O)Nc2cc(NC(=O)c3cccnc3)c([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C16H12N4O6/c1-26-16(23)13-9-5-12(20(24)25)11(6-10(9)18-15(13)22)19-14(21)8-3-2-4-17-7-8/h2-7,13H,1H3,(H,18,22)(H,19,21) |
| InChIKey | AAIDBLDNAIYAIU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|