C19H18N4O4 — CID 22162174
N-(5-nitro-2-oxospiro[1H-indole-3,1'-cyclohexane]-6-yl)pyridine-3-carboxamide (PubChem CID 22162174) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is N-(5-nitro-2-oxospiro[1H-indole-3,1'-cyclohexane]-6-yl)pyridine-3-carboxamide.
| Compound Name | N-(5-nitro-2-oxospiro[1H-indole-3,1'-cyclohexane]-6-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 22162174 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | N-(5-nitro-2-oxospiro[1H-indole-3,1'-cyclohexane]-6-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1cc2c(cc1[N+](=O)[O-])C1(CCCCC1)C(=O)N2)c1cccnc1 |
| InChI | InChI=1S/C19H18N4O4/c24-17(12-5-4-8-20-11-12)21-15-10-14-13(9-16(15)23(26)27)19(18(25)22-14)6-2-1-3-7-19/h4-5,8-11H,1-3,6-7H2,(H,21,24)(H,22,25) |
| InChIKey | IVBDOKSXXUVPMF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|