C18H17N3O2 — CID 97375619
1'-(pyridine-3-carbonyl)spiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 97375619) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 1'-(pyridine-3-carbonyl)spiro[1H-indole-3,4'-piperidine]-2-one.
| Compound Name | 1'-(pyridine-3-carbonyl)spiro[1H-indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 97375619 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 1'-(pyridine-3-carbonyl)spiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | O=C(c1cccnc1)N1CCC2(CC1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C18H17N3O2/c22-16(13-4-3-9-19-12-13)21-10-7-18(8-11-21)14-5-1-2-6-15(14)20-17(18)23/h1-6,9,12H,7-8,10-11H2,(H,20,23) |
| InChIKey | UDNRWMPXHMVTOG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |