About 1-[4-(3-cyano-4-heptylphenyl)phenyl]ethyl 5-methylheptanoate
1-[4-(3-cyano-4-heptylphenyl)phenyl]ethyl 5-methylheptanoate (PubChem CID 22162447) has the molecular formula C30H41NO2
and a molecular weight of 447.66 g/mol. Its IUPAC name is 1-[4-(3-cyano-4-heptylphenyl)phenyl]ethyl 5-methylheptanoate.
Molecular Properties
| Compound Name | 1-[4-(3-cyano-4-heptylphenyl)phenyl]ethyl 5-methylheptanoate |
| PubChem CID | 22162447 |
| Molecular Formula | C30H41NO2 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | 1-[4-(3-cyano-4-heptylphenyl)phenyl]ethyl 5-methylheptanoate |
| SMILES | CCCCCCCc1ccc(-c2ccc(C(C)OC(=O)CCCC(C)CC)cc2)cc1C#N |
| InChI | InChI=1S/C30H41NO2/c1-5-7-8-9-10-13-26-19-20-28(21-29(26)22-31)27-17-15-25(16-18-27)24(4)33-30(32)14-11-12-23(3)6-2/h15-21,23-24H,5-14H2,1-4H3 |
| InChIKey | DXHBNTAKBWKUMP-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(3-cyano-4-heptylphenyl)phenyl]ethyl 5-methylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3-cyano-4-heptylphenyl)phenyl]ethyl 5-methylheptanoate?
The IUPAC name of 1-[4-(3-cyano-4-heptylphenyl)phenyl]ethyl 5-methylheptanoate (CID 22162447) is 1-[4-(3-cyano-4-heptylphenyl)phenyl]ethyl 5-methylheptanoate.
What is the SMILES notation for 1-[4-(3-cyano-4-heptylphenyl)phenyl]ethyl 5-methylheptanoate?
The canonical SMILES for 1-[4-(3-cyano-4-heptylphenyl)phenyl]ethyl 5-methylheptanoate is CCCCCCCc1ccc(-c2ccc(C(C)OC(=O)CCCC(C)CC)cc2)cc1C#N.
What is the InChIKey of 1-[4-(3-cyano-4-heptylphenyl)phenyl]ethyl 5-methylheptanoate?
The InChIKey is DXHBNTAKBWKUMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H41NO2/c1-5-7-8-9-10-13-26-19-20-28(21-29(26)22-31)27-17-15-25(16-18-27)24(4)33-30(32)14-11-12-23(3)6-2/h15-21,23-24H,5-14H2,1-4H3.
What are the key properties of 1-[4-(3-cyano-4-heptylphenyl)phenyl]ethyl 5-methylheptanoate?
1-[4-(3-cyano-4-heptylphenyl)phenyl]ethyl 5-methylheptanoate has a molecular weight of 447.66 g/mol, XLogP of 8.56, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3-cyano-4-heptylphenyl)phenyl]ethyl 5-methylheptanoate is sourced from PubChem (CID 22162447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).