C5H4Cl3NS — CID 22163000
[(E)-2,3,4-trichlorobut-2-enyl] thiocyanate (PubChem CID 22163000) has the molecular formula C5H4Cl3NS and a molecular weight of 216.52 g/mol. Its IUPAC name is [(E)-2,3,4-trichlorobut-2-enyl] thiocyanate.
| Compound Name | [(E)-2,3,4-trichlorobut-2-enyl] thiocyanate |
|---|---|
| PubChem CID | 22163000 |
| Molecular Formula | C5H4Cl3NS |
| Molecular Weight | 216.52 g/mol |
| Exact Mass | 214.91 |
| IUPAC Name | [(E)-2,3,4-trichlorobut-2-enyl] thiocyanate |
| SMILES | N#CSC/C(Cl)=C(\Cl)CCl |
| InChI | InChI=1S/C5H4Cl3NS/c6-1-4(7)5(8)2-10-3-9/h1-2H2/b5-4+ |
| InChIKey | DSRRFVXCTABEMA-SNAWJCMRSA-N |
| XLogP | 3.13 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|