About 1-(2-hydroxy-5-oxo-2H-furan-3-yl)ethyl acetate;2-phenylethanamine
1-(2-hydroxy-5-oxo-2H-furan-3-yl)ethyl acetate;2-phenylethanamine (PubChem CID 22165574) has the molecular formula C16H21NO5
and a molecular weight of 307.35 g/mol. Its IUPAC name is 1-(2-hydroxy-5-oxo-2H-furan-3-yl)ethyl acetate;2-phenylethanamine.
Molecular Properties
| Compound Name | 1-(2-hydroxy-5-oxo-2H-furan-3-yl)ethyl acetate;2-phenylethanamine |
| PubChem CID | 22165574 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 1-(2-hydroxy-5-oxo-2H-furan-3-yl)ethyl acetate;2-phenylethanamine |
| SMILES | CC(=O)OC(C)C1=CC(=O)OC1O.NCCc1ccccc1 |
| InChI | InChI=1S/C8H11N.C8H10O5/c9-7-6-8-4-2-1-3-5-8;1-4(12-5(2)9)6-3-7(10)13-8(6)11/h1-5H,6-7,9H2;3-4,8,11H,1-2H3 |
| InChIKey | DEXZAFMJTZSPJE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2-hydroxy-5-oxo-2H-furan-3-yl)ethyl acetate;2-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxy-5-oxo-2H-furan-3-yl)ethyl acetate;2-phenylethanamine?
The IUPAC name of 1-(2-hydroxy-5-oxo-2H-furan-3-yl)ethyl acetate;2-phenylethanamine (CID 22165574) is 1-(2-hydroxy-5-oxo-2H-furan-3-yl)ethyl acetate;2-phenylethanamine.
What is the SMILES notation for 1-(2-hydroxy-5-oxo-2H-furan-3-yl)ethyl acetate;2-phenylethanamine?
The canonical SMILES for 1-(2-hydroxy-5-oxo-2H-furan-3-yl)ethyl acetate;2-phenylethanamine is CC(=O)OC(C)C1=CC(=O)OC1O.NCCc1ccccc1.
What is the InChIKey of 1-(2-hydroxy-5-oxo-2H-furan-3-yl)ethyl acetate;2-phenylethanamine?
The InChIKey is DEXZAFMJTZSPJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C8H10O5/c9-7-6-8-4-2-1-3-5-8;1-4(12-5(2)9)6-3-7(10)13-8(6)11/h1-5H,6-7,9H2;3-4,8,11H,1-2H3.
What are the key properties of 1-(2-hydroxy-5-oxo-2H-furan-3-yl)ethyl acetate;2-phenylethanamine?
1-(2-hydroxy-5-oxo-2H-furan-3-yl)ethyl acetate;2-phenylethanamine has a molecular weight of 307.35 g/mol, XLogP of 0.93, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxy-5-oxo-2H-furan-3-yl)ethyl acetate;2-phenylethanamine is sourced from PubChem (CID 22165574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).