C24H26O5 — CID 54173958
[1-(2-hydroxy-5-oxo-2H-furan-3-yl)-6-(4-phenylphenyl)hexyl] acetate (PubChem CID 54173958) has the molecular formula C24H26O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is [1-(2-hydroxy-5-oxo-2H-furan-3-yl)-6-(4-phenylphenyl)hexyl] acetate.
| Compound Name | [1-(2-hydroxy-5-oxo-2H-furan-3-yl)-6-(4-phenylphenyl)hexyl] acetate |
|---|---|
| PubChem CID | 54173958 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | [1-(2-hydroxy-5-oxo-2H-furan-3-yl)-6-(4-phenylphenyl)hexyl] acetate |
| SMILES | CC(=O)OC(CCCCCc1ccc(-c2ccccc2)cc1)C1=CC(=O)OC1O |
| InChI | InChI=1S/C24H26O5/c1-17(25)28-22(21-16-23(26)29-24(21)27)11-7-2-4-8-18-12-14-20(15-13-18)19-9-5-3-6-10-19/h3,5-6,9-10,12-16,22,24,27H,2,4,7-8,11H2,1H3 |
| InChIKey | OWYOPBUARPWKNQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|