C33H39N3O6 — CID 22165762
4-[[4,6-Bis(3-tert-butyl-4-hydroxyphenoxy)-1,3,5-triazin-2-yl]oxy]-2-tert-butylphenol (PubChem CID 22165762) has the molecular formula C33H39N3O6 and a molecular weight of 573.70 g/mol. Its IUPAC name is 4-[[4,6-bis(3-tert-butyl-4-hydroxyphenoxy)-1,3,5-triazin-2-yl]oxy]-2-tert-butylphenol.
| Compound Name | 4-[[4,6-Bis(3-tert-butyl-4-hydroxyphenoxy)-1,3,5-triazin-2-yl]oxy]-2-tert-butylphenol |
|---|---|
| PubChem CID | 22165762 |
| Molecular Formula | C33H39N3O6 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | 4-[[4,6-bis(3-tert-butyl-4-hydroxyphenoxy)-1,3,5-triazin-2-yl]oxy]-2-tert-butylphenol |
| SMILES | CC(C)(C)C1=C(C=CC(=C1)OC2=NC(=NC(=N2)OC3=CC(=C(C=C3)O)C(C)(C)C)OC4=CC(=C(C=C4)O)C(C)(C)C)O |
| InChI | InChI=1S/C33H39N3O6/c1-31(2,3)22-16-19(10-13-25(22)37)40-28-34-29(41-20-11-14-26(38)23(17-20)32(4,5)6)36-30(35-28)42-21-12-15-27(39)24(18-21)33(7,8)9/h10-18,37-39H,1-9H3 |
| InChIKey | PSGGPRGRQNURSQ-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | 733 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |