About (2,4-dicyclohexylphenyl) difluoro phosphite
(2,4-dicyclohexylphenyl) difluoro phosphite (PubChem CID 22166118) has the molecular formula C18H25F2O3P
and a molecular weight of 358.37 g/mol. Its IUPAC name is (2,4-dicyclohexylphenyl) difluoro phosphite.
Molecular Properties
| Compound Name | (2,4-dicyclohexylphenyl) difluoro phosphite |
| PubChem CID | 22166118 |
| Molecular Formula | C18H25F2O3P |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (2,4-dicyclohexylphenyl) difluoro phosphite |
| SMILES | FOP(OF)Oc1ccc(C2CCCCC2)cc1C1CCCCC1 |
| InChI | InChI=1S/C18H25F2O3P/c19-22-24(23-20)21-18-12-11-16(14-7-3-1-4-8-14)13-17(18)15-9-5-2-6-10-15/h11-15H,1-10H2 |
| InChIKey | UBBKOPVBAAQJEP-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dicyclohexylphenyl) difluoro phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dicyclohexylphenyl) difluoro phosphite?
The IUPAC name of (2,4-dicyclohexylphenyl) difluoro phosphite (CID 22166118) is (2,4-dicyclohexylphenyl) difluoro phosphite.
What is the SMILES notation for (2,4-dicyclohexylphenyl) difluoro phosphite?
The canonical SMILES for (2,4-dicyclohexylphenyl) difluoro phosphite is FOP(OF)Oc1ccc(C2CCCCC2)cc1C1CCCCC1.
What is the InChIKey of (2,4-dicyclohexylphenyl) difluoro phosphite?
The InChIKey is UBBKOPVBAAQJEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25F2O3P/c19-22-24(23-20)21-18-12-11-16(14-7-3-1-4-8-14)13-17(18)15-9-5-2-6-10-15/h11-15H,1-10H2.
What are the key properties of (2,4-dicyclohexylphenyl) difluoro phosphite?
(2,4-dicyclohexylphenyl) difluoro phosphite has a molecular weight of 358.37 g/mol, XLogP of 7.19, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dicyclohexylphenyl) difluoro phosphite is sourced from PubChem (CID 22166118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).