C21H21N7O4 — CID 22166443
N-(2-amino-2-oxo-1-phenylethyl)-2-(4-formylpiperazin-1-yl)-5-oxo-8H-pyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 22166443) has the molecular formula C21H21N7O4 and a molecular weight of 435.44 g/mol. Its IUPAC name is N-(2-amino-2-oxo-1-phenylethyl)-2-(4-formylpiperazin-1-yl)-5-oxo-8H-pyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-(2-amino-2-oxo-1-phenylethyl)-2-(4-formylpiperazin-1-yl)-5-oxo-8H-pyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 22166443 |
| Molecular Formula | C21H21N7O4 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-(2-amino-2-oxo-1-phenylethyl)-2-(4-formylpiperazin-1-yl)-5-oxo-8H-pyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | NC(=O)C(NC(=O)c1c[nH]c2nc(N3CCN(C=O)CC3)ncc2c1=O)c1ccccc1 |
| InChI | InChI=1S/C21H21N7O4/c22-18(31)16(13-4-2-1-3-5-13)25-20(32)15-11-23-19-14(17(15)30)10-24-21(26-19)28-8-6-27(12-29)7-9-28/h1-5,10-12,16H,6-9H2,(H2,22,31)(H,25,32)(H,23,24,26,30) |
| InChIKey | FGBUCVNAJKJIQX-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|