C18H15N3O2 — CID 51492407
N-[(1R)-2-amino-2-oxo-1-phenylethyl]quinoline-2-carboxamide (PubChem CID 51492407) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is N-[(1R)-2-amino-2-oxo-1-phenylethyl]quinoline-2-carboxamide.
| Compound Name | N-[(1R)-2-amino-2-oxo-1-phenylethyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 51492407 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[(1R)-2-amino-2-oxo-1-phenylethyl]quinoline-2-carboxamide |
| SMILES | NC(=O)[C@H](NC(=O)c1ccc2ccccc2n1)c1ccccc1 |
| InChI | InChI=1S/C18H15N3O2/c19-17(22)16(13-7-2-1-3-8-13)21-18(23)15-11-10-12-6-4-5-9-14(12)20-15/h1-11,16H,(H2,19,22)(H,21,23)/t16-/m1/s1 |
| InChIKey | RGENVJKZYCCGCE-MRXNPFEDSA-N |
| XLogP | 2.19 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |