C24H17Cl2N3O2 — CID 23796306
N-[2-(3-chloroanilino)-1-(4-chlorophenyl)-2-oxoethyl]quinoline-2-carboxamide (PubChem CID 23796306) has the molecular formula C24H17Cl2N3O2 and a molecular weight of 450.33 g/mol. Its IUPAC name is N-[2-(3-chloroanilino)-1-(4-chlorophenyl)-2-oxoethyl]quinoline-2-carboxamide.
| Compound Name | N-[2-(3-chloroanilino)-1-(4-chlorophenyl)-2-oxoethyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 23796306 |
| Molecular Formula | C24H17Cl2N3O2 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | N-[2-(3-chloroanilino)-1-(4-chlorophenyl)-2-oxoethyl]quinoline-2-carboxamide |
| SMILES | O=C(NC(C(=O)Nc1cccc(Cl)c1)c1ccc(Cl)cc1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C24H17Cl2N3O2/c25-17-11-8-16(9-12-17)22(24(31)27-19-6-3-5-18(26)14-19)29-23(30)21-13-10-15-4-1-2-7-20(15)28-21/h1-14,22H,(H,27,31)(H,29,30) |
| InChIKey | VXQHSPAYMHNXCJ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |