C12H14N3+ — CID 22167387
(E)-N-(2,3-dimethylimidazol-3-ium-1-yl)-1-phenylmethanimine (PubChem CID 22167387) has the molecular formula C12H14N3+ and a molecular weight of 200.27 g/mol. Its IUPAC name is (E)-N-(2,3-dimethylimidazol-3-ium-1-yl)-1-phenylmethanimine.
| Compound Name | (E)-N-(2,3-dimethylimidazol-3-ium-1-yl)-1-phenylmethanimine |
|---|---|
| PubChem CID | 22167387 |
| Molecular Formula | C12H14N3+ |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (E)-N-(2,3-dimethylimidazol-3-ium-1-yl)-1-phenylmethanimine |
| SMILES | Cc1n(/N=C/c2ccccc2)cc[n+]1C |
| InChI | InChI=1S/C12H14N3/c1-11-14(2)8-9-15(11)13-10-12-6-4-3-5-7-12/h3-10H,1-2H3/q+1/b13-10+ |
| InChIKey | BMONGLTVGKLXAV-JLHYYAGUSA-N |
| XLogP | 1.50 |
| TPSA | 21.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|