C14H19N4+ — CID 22167323
4-[(E)-(2,3-dimethylimidazol-3-ium-1-yl)iminomethyl]-N,N-dimethylaniline (PubChem CID 22167323) has the molecular formula C14H19N4+ and a molecular weight of 243.33 g/mol. Its IUPAC name is 4-[(E)-(2,3-dimethylimidazol-3-ium-1-yl)iminomethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-(2,3-dimethylimidazol-3-ium-1-yl)iminomethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 22167323 |
| Molecular Formula | C14H19N4+ |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 4-[(E)-(2,3-dimethylimidazol-3-ium-1-yl)iminomethyl]-N,N-dimethylaniline |
| SMILES | Cc1n(/N=C/c2ccc(N(C)C)cc2)cc[n+]1C |
| InChI | InChI=1S/C14H19N4/c1-12-17(4)9-10-18(12)15-11-13-5-7-14(8-6-13)16(2)3/h5-11H,1-4H3/q+1/b15-11+ |
| InChIKey | YRAVKDOAMYYFAD-RVDMUPIBSA-N |
| XLogP | 1.57 |
| TPSA | 24.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|