C22H27N6+ — CID 54207494
4-[[3-[[4-(dimethylamino)phenyl]methylideneamino]-5-methylimidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline (PubChem CID 54207494) has the molecular formula C22H27N6+ and a molecular weight of 375.50 g/mol. Its IUPAC name is 4-[[3-[[4-(dimethylamino)phenyl]methylideneamino]-5-methylimidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline.
| Compound Name | 4-[[3-[[4-(dimethylamino)phenyl]methylideneamino]-5-methylimidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 54207494 |
| Molecular Formula | C22H27N6+ |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 4-[[3-[[4-(dimethylamino)phenyl]methylideneamino]-5-methylimidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline |
| SMILES | Cc1c[n+](N=Cc2ccc(N(C)C)cc2)cn1N=Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H27N6/c1-18-16-27(23-14-19-6-10-21(11-7-19)25(2)3)17-28(18)24-15-20-8-12-22(13-9-20)26(4)5/h6-17H,1-5H3/q+1 |
| InChIKey | PTODCLXZGRFJBX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 40.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|