C21H25N6+ — CID 21274031
4-[(E)-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]imidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline (PubChem CID 21274031) has the molecular formula C21H25N6+ and a molecular weight of 361.47 g/mol. Its IUPAC name is 4-[(E)-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]imidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]imidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 21274031 |
| Molecular Formula | C21H25N6+ |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 4-[(E)-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]imidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=N/n2cc[n+](/N=C/c3ccc(N(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C21H25N6/c1-24(2)20-9-5-18(6-10-20)15-22-26-13-14-27(17-26)23-16-19-7-11-21(12-8-19)25(3)4/h5-17H,1-4H3/q+1/b22-15+,23-16+ |
| InChIKey | QVDXJFDMBVJYFO-QAOSGDJLSA-N |
| XLogP | 2.67 |
| TPSA | 40.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|