C23H29ClN6 — CID 173396563
4-[(E)-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-ethylimidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline chloride (PubChem CID 173396563) has the molecular formula C23H29ClN6 and a molecular weight of 424.98 g/mol. Its IUPAC name is 4-[(E)-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-ethylimidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline chloride.
| Compound Name | 4-[(E)-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-ethylimidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline chloride |
|---|---|
| PubChem CID | 173396563 |
| Molecular Formula | C23H29ClN6 |
| Molecular Weight | 424.98 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 4-[(E)-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-ethylimidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline chloride |
| SMILES | CCc1n(/N=C/c2ccc(N(C)C)cc2)cc[n+]1/N=C/c1ccc(N(C)C)cc1.[Cl-] |
| InChI | InChI=1S/C23H29N6.ClH/c1-6-23-28(24-17-19-7-11-21(12-8-19)26(2)3)15-16-29(23)25-18-20-9-13-22(14-10-20)27(4)5;/h7-18H,6H2,1-5H3;1H/q+1;/p-1/b24-17+,25-18+; |
| InChIKey | CYVCRZKOCKUGJY-LHSVSCCHSA-M |
| XLogP | 0.24 |
| TPSA | 40.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.98 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|