C20H29BrN4O — CID 88629104
1-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-ethylimidazol-1-ium-1-yl]-3,3-dimethylbutan-2-one bromide (PubChem CID 88629104) has the molecular formula C20H29BrN4O and a molecular weight of 421.38 g/mol. Its IUPAC name is 1-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-ethylimidazol-1-ium-1-yl]-3,3-dimethylbutan-2-one bromide.
| Compound Name | 1-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-ethylimidazol-1-ium-1-yl]-3,3-dimethylbutan-2-one bromide |
|---|---|
| PubChem CID | 88629104 |
| Molecular Formula | C20H29BrN4O |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 1-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-ethylimidazol-1-ium-1-yl]-3,3-dimethylbutan-2-one bromide |
| SMILES | CCc1n(/N=C/c2ccc(N(C)C)cc2)cc[n+]1CC(=O)C(C)(C)C.[Br-] |
| InChI | InChI=1S/C20H29N4O.BrH/c1-7-19-23(15-18(25)20(2,3)4)12-13-24(19)21-14-16-8-10-17(11-9-16)22(5)6;/h8-14H,7,15H2,1-6H3;1H/q+1;/p-1/b21-14+; |
| InChIKey | UAEXCHHYXAMBRO-UNLLECTCSA-M |
| XLogP | -0.09 |
| TPSA | 41.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|