C24H28N5O3+ — CID 54013634
1-[3-[[4-(dimethylamino)phenyl]methylideneamino]-2-(4-nitrophenyl)imidazol-1-ium-1-yl]-3,3-dimethylbutan-2-one (PubChem CID 54013634) has the molecular formula C24H28N5O3+ and a molecular weight of 434.52 g/mol. Its IUPAC name is 1-[3-[[4-(dimethylamino)phenyl]methylideneamino]-2-(4-nitrophenyl)imidazol-1-ium-1-yl]-3,3-dimethylbutan-2-one.
| Compound Name | 1-[3-[[4-(dimethylamino)phenyl]methylideneamino]-2-(4-nitrophenyl)imidazol-1-ium-1-yl]-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 54013634 |
| Molecular Formula | C24H28N5O3+ |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 1-[3-[[4-(dimethylamino)phenyl]methylideneamino]-2-(4-nitrophenyl)imidazol-1-ium-1-yl]-3,3-dimethylbutan-2-one |
| SMILES | CN(C)c1ccc(C=Nn2cc[n+](CC(=O)C(C)(C)C)c2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H28N5O3/c1-24(2,3)22(30)17-27-14-15-28(23(27)19-8-12-21(13-9-19)29(31)32)25-16-18-6-10-20(11-7-18)26(4)5/h6-16H,17H2,1-5H3/q+1 |
| InChIKey | KUCAGIRVXRHUOZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 84.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|