C27H26BrN5O4 — CID 70360848
2-[3-[[4-(dimethylamino)phenyl]methylideneamino]-2-(4-methoxyphenyl)imidazol-1-ium-1-yl]-1-(4-nitrophenyl)ethanone bromide (PubChem CID 70360848) has the molecular formula C27H26BrN5O4 and a molecular weight of 564.44 g/mol. Its IUPAC name is 2-[3-[[4-(dimethylamino)phenyl]methylideneamino]-2-(4-methoxyphenyl)imidazol-1-ium-1-yl]-1-(4-nitrophenyl)ethanone bromide.
| Compound Name | 2-[3-[[4-(dimethylamino)phenyl]methylideneamino]-2-(4-methoxyphenyl)imidazol-1-ium-1-yl]-1-(4-nitrophenyl)ethanone bromide |
|---|---|
| PubChem CID | 70360848 |
| Molecular Formula | C27H26BrN5O4 |
| Molecular Weight | 564.44 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | 2-[3-[[4-(dimethylamino)phenyl]methylideneamino]-2-(4-methoxyphenyl)imidazol-1-ium-1-yl]-1-(4-nitrophenyl)ethanone bromide |
| SMILES | COc1ccc(-c2n(N=Cc3ccc(N(C)C)cc3)cc[n+]2CC(=O)c2ccc([N+](=O)[O-])cc2)cc1.[Br-] |
| InChI | InChI=1S/C27H26N5O4.BrH/c1-29(2)23-10-4-20(5-11-23)18-28-31-17-16-30(27(31)22-8-14-25(36-3)15-9-22)19-26(33)21-6-12-24(13-7-21)32(34)35;/h4-18H,19H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | IWQCKHGBOMLVAW-UHFFFAOYSA-M |
| XLogP | 1.19 |
| TPSA | 93.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.44 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|