C25H31N4O4+ — CID 54422920
2-[3-[[4-(dimethylamino)phenyl]methylideneamino]-2-ethylimidazol-1-ium-1-yl]-1-(3,4,5-trimethoxyphenyl)ethanone (PubChem CID 54422920) has the molecular formula C25H31N4O4+ and a molecular weight of 451.55 g/mol. Its IUPAC name is 2-[3-[[4-(dimethylamino)phenyl]methylideneamino]-2-ethylimidazol-1-ium-1-yl]-1-(3,4,5-trimethoxyphenyl)ethanone.
| Compound Name | 2-[3-[[4-(dimethylamino)phenyl]methylideneamino]-2-ethylimidazol-1-ium-1-yl]-1-(3,4,5-trimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 54422920 |
| Molecular Formula | C25H31N4O4+ |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 2-[3-[[4-(dimethylamino)phenyl]methylideneamino]-2-ethylimidazol-1-ium-1-yl]-1-(3,4,5-trimethoxyphenyl)ethanone |
| SMILES | CCc1n(N=Cc2ccc(N(C)C)cc2)cc[n+]1CC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C25H31N4O4/c1-7-24-28(12-13-29(24)26-16-18-8-10-20(11-9-18)27(2)3)17-21(30)19-14-22(31-4)25(33-6)23(15-19)32-5/h8-16H,7,17H2,1-6H3/q+1 |
| InChIKey | WCBARTQKCKWCGY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|