C25H31BrN4O — CID 88606460
1-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-(4-methylphenyl)imidazol-1-ium-1-yl]-3,3-dimethylbutan-2-one bromide (PubChem CID 88606460) has the molecular formula C25H31BrN4O and a molecular weight of 483.45 g/mol. Its IUPAC name is 1-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-(4-methylphenyl)imidazol-1-ium-1-yl]-3,3-dimethylbutan-2-one bromide.
| Compound Name | 1-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-(4-methylphenyl)imidazol-1-ium-1-yl]-3,3-dimethylbutan-2-one bromide |
|---|---|
| PubChem CID | 88606460 |
| Molecular Formula | C25H31BrN4O |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 1-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-(4-methylphenyl)imidazol-1-ium-1-yl]-3,3-dimethylbutan-2-one bromide |
| SMILES | Cc1ccc(-c2n(/N=C/c3ccc(N(C)C)cc3)cc[n+]2CC(=O)C(C)(C)C)cc1.[Br-] |
| InChI | InChI=1S/C25H31N4O.BrH/c1-19-7-11-21(12-8-19)24-28(18-23(30)25(2,3)4)15-16-29(24)26-17-20-9-13-22(14-10-20)27(5)6;/h7-17H,18H2,1-6H3;1H/q+1;/p-1/b26-17+; |
| InChIKey | KCAKNYFBLCZXEQ-VOGLITBBSA-M |
| XLogP | 1.32 |
| TPSA | 41.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|