C14H20ClN5 — CID 88629276
3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-ethylimidazol-1-ium-1-amine chloride (PubChem CID 88629276) has the molecular formula C14H20ClN5 and a molecular weight of 293.80 g/mol. Its IUPAC name is 3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-ethylimidazol-1-ium-1-amine chloride.
| Compound Name | 3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-ethylimidazol-1-ium-1-amine chloride |
|---|---|
| PubChem CID | 88629276 |
| Molecular Formula | C14H20ClN5 |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-ethylimidazol-1-ium-1-amine chloride |
| SMILES | CCc1n(/N=C/c2ccc(N(C)C)cc2)cc[n+]1N.[Cl-] |
| InChI | InChI=1S/C14H20N5.ClH/c1-4-14-18(15)9-10-19(14)16-11-12-5-7-13(8-6-12)17(2)3;/h5-11H,4,15H2,1-3H3;1H/q+1;/p-1/b16-11+; |
| InChIKey | ZUUUONILRFUYBW-YFMOEUEHSA-M |
| XLogP | -2.00 |
| TPSA | 50.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|